C18H27N3O2 — CID 120750320
N-[6-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-6-oxohexyl]acetamide (PubChem CID 120750320) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[6-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-6-oxohexyl]acetamide.
| Compound Name | N-[6-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 120750320 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-[6-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-14(22)20-11-7-3-6-10-18(23)21-12-16(17(19)13-21)15-8-4-2-5-9-15/h2,4-5,8-9,16-17H,3,6-7,10-13,19H2,1H3,(H,20,22)/t16-,17+/m0/s1 |
| InChIKey | ICCFMDHBJFEXTB-DLBZAZTESA-N |
| XLogP | 1.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|