C15H16Cl4N6O2S2 — CID 129430642
[(E)-[(1R,2S,3S,5S,6R,7S,9S,10R,11E)-11-(carbamothioylhydrazinylidene)-2,3,5,6-tetrachloro-4,4-dimethoxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]thiourea (PubChem CID 129430642) has the molecular formula C15H16Cl4N6O2S2 and a molecular weight of 518.28 g/mol. Its IUPAC name is [(E)-[(1R,2S,3S,5S,6R,7S,9S,10R,11E)-11-(carbamothioylhydrazinylidene)-2,3,5,6-tetrachloro-4,4-dimethoxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]thiourea.
| Compound Name | [(E)-[(1R,2S,3S,5S,6R,7S,9S,10R,11E)-11-(carbamothioylhydrazinylidene)-2,3,5,6-tetrachloro-4,4-dimethoxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]thiourea |
|---|---|
| PubChem CID | 129430642 |
| Molecular Formula | C15H16Cl4N6O2S2 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 515.95 |
| IUPAC Name | [(E)-[(1R,2S,3S,5S,6R,7S,9S,10R,11E)-11-(carbamothioylhydrazinylidene)-2,3,5,6-tetrachloro-4,4-dimethoxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]amino]thiourea |
| SMILES | COC1(OC)[C@@]2(Cl)[C@H]3C(=NNC(N)=S)[C@H]4[C@H]5/C(=N/NC(N)=S)[C@H]3[C@@]1(Cl)[C@@]5(Cl)[C@]42Cl |
| InChI | InChI=1S/C15H16Cl4N6O2S2/c1-26-15(27-2)13(18)5-6-8(23-25-10(21)29)4-3(7(5)22-24-9(20)28)11(13,16)12(4,17)14(6,15)19/h3-6H,1-2H3,(H3,20,24,28)(H3,21,25,29)/b22-7-,23-8?/t3-,4+,5-,6+,11-,12+,13+,14+/m0/s1 |
| InChIKey | GPISEBNDYFTGNA-IWCIJKHQSA-N |
| XLogP | 0.80 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|