C9H15N3O2S — CID 99995804
cis-(1R,3Z,4R)-3-(carbamothioylhydrazinylidene)-1,4-dimethylcyclopentane-1-carboxylic acid (PubChem CID 99995804) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is cis-(1R,3Z,4R)-3-(carbamothioylhydrazinylidene)-1,4-dimethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3Z,4R)-3-(carbamothioylhydrazinylidene)-1,4-dimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 99995804 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | cis-(1R,3Z,4R)-3-(carbamothioylhydrazinylidene)-1,4-dimethylcyclopentane-1-carboxylic acid |
| SMILES | C[C@@H]1C[C@@](C)(C(=O)O)C/C1=N/NC(N)=S |
| InChI | InChI=1S/C9H15N3O2S/c1-5-3-9(2,7(13)14)4-6(5)11-12-8(10)15/h5H,3-4H2,1-2H3,(H,13,14)(H3,10,12,15)/b11-6-/t5-,9-/m1/s1 |
| InChIKey | DFTBNHNPRXBYBL-VWGKMGFHSA-N |
| XLogP | 0.70 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|