C9H15NO3 — CID 102568719
(3E)-3-methoxyimino-1,4-dimethylcyclopentane-1-carboxylic acid (PubChem CID 102568719) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (3E)-3-methoxyimino-1,4-dimethylcyclopentane-1-carboxylic acid.
| Compound Name | (3E)-3-methoxyimino-1,4-dimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 102568719 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3E)-3-methoxyimino-1,4-dimethylcyclopentane-1-carboxylic acid |
| SMILES | CO/N=C1\CC(C)(C(=O)O)CC1C |
| InChI | InChI=1S/C9H15NO3/c1-6-4-9(2,8(11)12)5-7(6)10-13-3/h6H,4-5H2,1-3H3,(H,11,12)/b10-7+ |
| InChIKey | ZDQLHPVCOKDRIT-JXMROGBWSA-N |
| XLogP | 1.51 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|