C9H13NO3 — CID 102568381
(2E)-2-methoxyiminobicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 102568381) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2E)-2-methoxyiminobicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (2E)-2-methoxyiminobicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 102568381 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2E)-2-methoxyiminobicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CO/N=C1\CC2CCC1(C(=O)O)C2 |
| InChI | InChI=1S/C9H13NO3/c1-13-10-7-4-6-2-3-9(7,5-6)8(11)12/h6H,2-5H2,1H3,(H,11,12)/b10-7+ |
| InChIKey | LZOHEIJOHJIBDT-JXMROGBWSA-N |
| XLogP | 1.26 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|