C8H12N2O2 — CID 99990943
(1S,2Z,4R)-2-hydrazinylidenebicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 99990943) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (1S,2Z,4R)-2-hydrazinylidenebicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (1S,2Z,4R)-2-hydrazinylidenebicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 99990943 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (1S,2Z,4R)-2-hydrazinylidenebicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | N/N=C1/C[C@@H]2CC[C@]1(C(=O)O)C2 |
| InChI | InChI=1S/C8H12N2O2/c9-10-6-3-5-1-2-8(6,4-5)7(11)12/h5H,1-4,9H2,(H,11,12)/b10-6-/t5-,8-/m0/s1 |
| InChIKey | YWAZIKONSBNTNC-GUZQTAPTSA-N |
| XLogP | 0.58 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|