C13H18F8O2 — CID 21325419
1,1,2,2,3,3,4,4-octafluoro-5,5-bis[(2-methylpropan-2-yl)oxy]cyclopentane (PubChem CID 21325419) has the molecular formula C13H18F8O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-5,5-bis[(2-methylpropan-2-yl)oxy]cyclopentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-5,5-bis[(2-methylpropan-2-yl)oxy]cyclopentane |
|---|---|
| PubChem CID | 21325419 |
| Molecular Formula | C13H18F8O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-5,5-bis[(2-methylpropan-2-yl)oxy]cyclopentane |
| SMILES | CC(C)(C)OC1(OC(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H18F8O2/c1-7(2,3)22-13(23-8(4,5)6)11(18,19)9(14,15)10(16,17)12(13,20)21/h1-6H3 |
| InChIKey | VNLVZLHOTGOYHW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|