C6HF11S — CID 87424981
1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-thiol (PubChem CID 87424981) has the molecular formula C6HF11S and a molecular weight of 314.12 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-thiol.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-thiol |
|---|---|
| PubChem CID | 87424981 |
| Molecular Formula | C6HF11S |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-thiol |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(S)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6HF11S/c7-1(8)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12/h18H |
| InChIKey | OLWKAAZOKGFNKF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|