C11H17F3O3S — CID 134895814
(4,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl) trifluoromethanesulfonate (PubChem CID 134895814) has the molecular formula C11H17F3O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is (4,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl) trifluoromethanesulfonate.
| Compound Name | (4,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134895814 |
| Molecular Formula | C11H17F3O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (4,7,7-trimethyl-1-bicyclo[2.2.1]heptanyl) trifluoromethanesulfonate |
| SMILES | CC12CCC(OS(=O)(=O)C(F)(F)F)(CC1)C2(C)C |
| InChI | InChI=1S/C11H17F3O3S/c1-8(2)9(3)4-6-10(8,7-5-9)17-18(15,16)11(12,13)14/h4-7H2,1-3H3 |
| InChIKey | BHFKAIXNNAMKRS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|