C10H11F3O5S — CID 101217855
[(1R,4S)-3,3-dimethyl-2,7-dioxo-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate (PubChem CID 101217855) has the molecular formula C10H11F3O5S and a molecular weight of 300.25 g/mol. Its IUPAC name is [(1R,4S)-3,3-dimethyl-2,7-dioxo-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate.
| Compound Name | [(1R,4S)-3,3-dimethyl-2,7-dioxo-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101217855 |
| Molecular Formula | C10H11F3O5S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | [(1R,4S)-3,3-dimethyl-2,7-dioxo-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
| SMILES | CC1(C)C(=O)[C@@]2(OS(=O)(=O)C(F)(F)F)CC[C@@H]1C2=O |
| InChI | InChI=1S/C10H11F3O5S/c1-8(2)5-3-4-9(6(5)14,7(8)15)18-19(16,17)10(11,12)13/h5H,3-4H2,1-2H3/t5-,9-/m1/s1 |
| InChIKey | NCURGBIWWAVKLT-MLUIRONXSA-N |
| XLogP | 1.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|