C12H16ClF3O3S — CID 11393436
[(1R,4R,7S)-7-(chloromethyl)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate (PubChem CID 11393436) has the molecular formula C12H16ClF3O3S and a molecular weight of 332.77 g/mol. Its IUPAC name is [(1R,4R,7S)-7-(chloromethyl)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate.
| Compound Name | [(1R,4R,7S)-7-(chloromethyl)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11393436 |
| Molecular Formula | C12H16ClF3O3S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [(1R,4R,7S)-7-(chloromethyl)-3,3-dimethyl-2-methylidene-1-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1(OS(=O)(=O)C(F)(F)F)[C@H]2CCl |
| InChI | InChI=1S/C12H16ClF3O3S/c1-7-10(2,3)8-4-5-11(7,9(8)6-13)19-20(17,18)12(14,15)16/h8-9H,1,4-6H2,2-3H3/t8-,9+,11+/m1/s1 |
| InChIKey | IXXUJWTUNDSEPT-YWVKMMECSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|