C14H15F3O3S — CID 136882738
[(1R,2S,3S,4S)-3-deuterio-2-phenyl-2-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate (PubChem CID 136882738) has the molecular formula C14H15F3O3S and a molecular weight of 321.34 g/mol. Its IUPAC name is [(1R,2S,3S,4S)-3-deuterio-2-phenyl-2-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate.
| Compound Name | [(1R,2S,3S,4S)-3-deuterio-2-phenyl-2-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 136882738 |
| Molecular Formula | C14H15F3O3S |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [(1R,2S,3S,4S)-3-deuterio-2-phenyl-2-bicyclo[2.2.1]heptanyl] trifluoromethanesulfonate |
| SMILES | [2H][C@H]1[C@H]2CC[C@H](C2)[C@]1(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15F3O3S/c15-14(16,17)21(18,19)20-13(11-4-2-1-3-5-11)9-10-6-7-12(13)8-10/h1-5,10,12H,6-9H2/t10-,12+,13+/m0/s1/i9D/t9-,10-,12+,13+ |
| InChIKey | OOVLZYWUIFOLTF-WURTVCBFSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|