C10H12BrF3O3S — CID 89043871
[(1R,4S)-3-bromo-7,7-dimethyl-2-bicyclo[2.2.1]hept-2-enyl] trifluoromethanesulfonate (PubChem CID 89043871) has the molecular formula C10H12BrF3O3S and a molecular weight of 349.17 g/mol. Its IUPAC name is [(1R,4S)-3-bromo-7,7-dimethyl-2-bicyclo[2.2.1]hept-2-enyl] trifluoromethanesulfonate.
| Compound Name | [(1R,4S)-3-bromo-7,7-dimethyl-2-bicyclo[2.2.1]hept-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89043871 |
| Molecular Formula | C10H12BrF3O3S |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | [(1R,4S)-3-bromo-7,7-dimethyl-2-bicyclo[2.2.1]hept-2-enyl] trifluoromethanesulfonate |
| SMILES | CC1(C)[C@@H]2CC[C@H]1C(OS(=O)(=O)C(F)(F)F)=C2Br |
| InChI | InChI=1S/C10H12BrF3O3S/c1-9(2)5-3-4-6(9)8(7(5)11)17-18(15,16)10(12,13)14/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | IQZAHWHKXKXLMZ-RITPCOANSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|