C12H17F3O3S — CID 85265549
(7,7-dimethylspiro[bicyclo[2.2.1]heptane-2,1'-cyclopropane]-1-yl) trifluoromethanesulfonate (PubChem CID 85265549) has the molecular formula C12H17F3O3S and a molecular weight of 298.33 g/mol. Its IUPAC name is (7,7-dimethylspiro[bicyclo[2.2.1]heptane-2,1'-cyclopropane]-1-yl) trifluoromethanesulfonate.
| Compound Name | (7,7-dimethylspiro[bicyclo[2.2.1]heptane-2,1'-cyclopropane]-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 85265549 |
| Molecular Formula | C12H17F3O3S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (7,7-dimethylspiro[bicyclo[2.2.1]heptane-2,1'-cyclopropane]-1-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)C2CCC1(OS(=O)(=O)C(F)(F)F)C1(CC1)C2 |
| InChI | InChI=1S/C12H17F3O3S/c1-9(2)8-3-4-11(9,10(7-8)5-6-10)18-19(16,17)12(13,14)15/h8H,3-7H2,1-2H3 |
| InChIKey | IWBVLVMJVZRNOE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|