C12H18O3 — CID 18936144
(2-formyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) formate (PubChem CID 18936144) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2-formyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) formate.
| Compound Name | (2-formyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) formate |
|---|---|
| PubChem CID | 18936144 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2-formyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) formate |
| SMILES | CC1(C)C2CCC1(C)C(C=O)(OC=O)C2 |
| InChI | InChI=1S/C12H18O3/c1-10(2)9-4-5-11(10,3)12(6-9,7-13)15-8-14/h7-9H,4-6H2,1-3H3 |
| InChIKey | CYRXDURGTQRKEF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|