C26H38O6 — CID 174729550
3-[(1S,4R)-2-[2,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexa-2,4-dienoyl]oxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-methylprop-2-enoic acid (PubChem CID 174729550) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 3-[(1S,4R)-2-[2,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexa-2,4-dienoyl]oxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[(1S,4R)-2-[2,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexa-2,4-dienoyl]oxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174729550 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 3-[(1S,4R)-2-[2,5-dimethyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexa-2,4-dienoyl]oxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1(OC(=O)C(C)=CC=C(C)C(=O)OC(C)(C)C)C[C@H]2CC[C@@]1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C26H38O6/c1-16(21(29)31-23(4,5)6)10-11-17(2)22(30)32-26(14-18(3)20(27)28)15-19-12-13-25(26,9)24(19,7)8/h10-11,14,19H,12-13,15H2,1-9H3,(H,27,28)/t19-,25+,26?/m1/s1 |
| InChIKey | ZFBCIQAYBBJIKR-ZWVLWNBXSA-N |
| XLogP | 5.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|