C39H64O4 — CID 70178895
tert-butyl 2,6,6-trimethyl-2-[2,6,6-trimethyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]bicyclo[3.1.1]heptane-1-carboxylate;2-methylprop-2-enoic acid (PubChem CID 70178895) has the molecular formula C39H64O4 and a molecular weight of 596.94 g/mol. Its IUPAC name is tert-butyl 2,6,6-trimethyl-2-[2,6,6-trimethyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]bicyclo[3.1.1]heptane-1-carboxylate;2-methylprop-2-enoic acid.
| Compound Name | tert-butyl 2,6,6-trimethyl-2-[2,6,6-trimethyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]bicyclo[3.1.1]heptane-1-carboxylate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 70178895 |
| Molecular Formula | C39H64O4 |
| Molecular Weight | 596.94 g/mol |
| Exact Mass | 596.48 |
| IUPAC Name | tert-butyl 2,6,6-trimethyl-2-[2,6,6-trimethyl-2-(2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl)-1-bicyclo[3.1.1]heptanyl]bicyclo[3.1.1]heptane-1-carboxylate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC(C)(C)OC(=O)C12CC(CCC1(C)C13CC(CCC1(C)C1(C)CCC4CC1C4(C)C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C35H58O2.C4H6O2/c1-27(2,3)37-26(36)34-20-23(29(34,6)7)15-18-33(34,12)35-21-24(30(35,8)9)14-17-32(35,11)31(10)16-13-22-19-25(31)28(22,4)5;1-3(2)4(5)6/h22-25H,13-21H2,1-12H3;1H2,2H3,(H,5,6) |
| InChIKey | VTXYUCVNIAWASQ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.94 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|