C19H30O4 — CID 155255757
1-O-tert-butyl 4-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylidenebutanedioate (PubChem CID 155255757) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylidenebutanedioate.
| Compound Name | 1-O-tert-butyl 4-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155255757 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-O-tert-butyl 4-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30O4/c1-12(16(21)23-17(2,3)4)10-15(20)22-14-11-13-8-9-19(14,7)18(13,5)6/h13-14H,1,8-11H2,2-7H3 |
| InChIKey | KDXKCSOCYOUACK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|