C21H34O4 — CID 174534276
butyl 2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174534276) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is butyl 2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | butyl 2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174534276 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | butyl 2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C(=O)OCCCC)C1C[C@H]2CC[C@@]1(C)C2(C)C.C=C(C)C(=O)O |
| InChI | InChI=1S/C17H28O2.C4H6O2/c1-6-7-10-19-15(18)12(2)14-11-13-8-9-17(14,5)16(13,3)4;1-3(2)4(5)6/h13-14H,2,6-11H2,1,3-5H3;1H2,2H3,(H,5,6)/t13-,14?,17-;/m1./s1 |
| InChIKey | LZULEQAHNVQCPK-HTUXSCOVSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|