C25H38O8 — CID 66606567
(Z)-4-butoxy-4-oxobut-2-enoic acid;ethenyl acetate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate (PubChem CID 66606567) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is (Z)-4-butoxy-4-oxobut-2-enoic acid;ethenyl acetate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate.
| Compound Name | (Z)-4-butoxy-4-oxobut-2-enoic acid;ethenyl acetate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate |
|---|---|
| PubChem CID | 66606567 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (Z)-4-butoxy-4-oxobut-2-enoic acid;ethenyl acetate;(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CCC1(C)C2(C)C.C=COC(C)=O.CCCCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H20O2.C8H12O4.C4H6O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3;1-2-3-6-12-8(11)5-4-7(9)10;1-3-6-4(2)5/h5,9-10H,1,6-8H2,2-4H3;4-5H,2-3,6H2,1H3,(H,9,10);3H,1H2,2H3/b;5-4-; |
| InChIKey | RJUQBWBZJJHOII-FXHNQCOHSA-N |
| XLogP | 4.59 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|