C19H26O4 — CID 174049567
2-methyl-3-(2-methylidenebut-3-enoyloxy)-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid (PubChem CID 174049567) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-methyl-3-(2-methylidenebut-3-enoyloxy)-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid.
| Compound Name | 2-methyl-3-(2-methylidenebut-3-enoyloxy)-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 174049567 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-methyl-3-(2-methylidenebut-3-enoyloxy)-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid |
| SMILES | C=CC(=C)C(=O)OC(=C(C)C(=O)O)C1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C19H26O4/c1-7-11(2)17(22)23-15(12(3)16(20)21)14-10-13-8-9-19(14,6)18(13,4)5/h7,13-14H,1-2,8-10H2,3-6H3,(H,20,21)/t13-,14?,19-/m1/s1 |
| InChIKey | YYBPVCCBVNKOKQ-BOOUNLCJSA-N |
| XLogP | 4.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|