C20H34O5 — CID 174847715
[2-ethoxy-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethyl] acetate;2-methylprop-2-enoic acid (PubChem CID 174847715) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is [2-ethoxy-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethyl] acetate;2-methylprop-2-enoic acid.
| Compound Name | [2-ethoxy-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethyl] acetate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174847715 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [2-ethoxy-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)ethyl] acetate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCOCC(OC(C)=O)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C16H28O3.C4H6O2/c1-6-18-10-14(19-11(2)17)13-9-12-7-8-16(13,5)15(12,3)4;1-3(2)4(5)6/h12-14H,6-10H2,1-5H3;1H2,2H3,(H,5,6) |
| InChIKey | WXNHHLZUFGENGC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|