C25H40O4 — CID 98136780
[(1R,2S,4S)-1,7,7-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 98136780) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is [(1R,2S,4S)-1,7,7-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [(1R,2S,4S)-1,7,7-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 98136780 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(1R,2S,4S)-1,7,7-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@]1(C#CC(C)(C)OOC(C)(C)CCC)C[C@@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C25H40O4/c1-11-13-21(4,5)28-29-22(6,7)15-16-25(27-20(26)18(2)3)17-19-12-14-24(25,10)23(19,8)9/h19H,2,11-14,17H2,1,3-10H3/t19-,24+,25+/m0/s1 |
| InChIKey | LTVYYZVESNBABP-QTLGCAHFSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|