C36H48O6 — CID 3808451
[13-methyl-17-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-17-(2-methylprop-2-enoyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate (PubChem CID 3808451) has the molecular formula C36H48O6 and a molecular weight of 576.77 g/mol. Its IUPAC name is [13-methyl-17-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-17-(2-methylprop-2-enoyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate.
| Compound Name | [13-methyl-17-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-17-(2-methylprop-2-enoyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 3808451 |
| Molecular Formula | C36H48O6 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | [13-methyl-17-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-17-(2-methylprop-2-enoyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C1CCC2(C#CC(C)(C)OOC(C)(C)CC)OC(=O)C(=C)C |
| InChI | InChI=1S/C36H48O6/c1-11-33(6,7)41-42-34(8,9)20-21-36(40-32(38)24(4)5)19-17-30-29-14-12-25-22-26(39-31(37)23(2)3)13-15-27(25)28(29)16-18-35(30,36)10/h13,15,22,28-30H,2,4,11-12,14,16-19H2,1,3,5-10H3 |
| InChIKey | XSWFWWRZCMSVDA-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|