C23H32O3S — CID 174178390
[(8S,9S,13S,14S,17R)-13,17-dimethyl-17-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 174178390) has the molecular formula C23H32O3S and a molecular weight of 388.57 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17R)-13,17-dimethyl-17-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(8S,9S,13S,14S,17R)-13,17-dimethyl-17-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 174178390 |
| Molecular Formula | C23H32O3S |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | [(8S,9S,13S,14S,17R)-13,17-dimethyl-17-prop-2-enyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | C=CC[C@@]1(C)CC[C@H]2[C@@H]3CCc4cc(OS(C)(=O)=O)ccc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H32O3S/c1-5-12-22(2)13-11-21-20-8-6-16-15-17(26-27(4,24)25)7-9-18(16)19(20)10-14-23(21,22)3/h5,7,9,15,19-21H,1,6,8,10-14H2,2-4H3/t19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | NZJTXKXDTCTQJJ-VROINQGHSA-N |
| XLogP | 5.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|