C24H38O4 — CID 3765391
[5,5,6-trimethyl-2-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 3765391) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [5,5,6-trimethyl-2-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5,5,6-trimethyl-2-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 3765391 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [5,5,6-trimethyl-2-[3-methyl-3-(2-methylbutan-2-ylperoxy)but-1-ynyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C#CC(C)(C)OOC(C)(C)CC)CC2CC1C(C)C2(C)C |
| InChI | InChI=1S/C24H38O4/c1-11-21(5,6)27-28-22(7,8)12-13-24(26-20(25)16(2)3)15-18-14-19(24)17(4)23(18,9)10/h17-19H,2,11,14-15H2,1,3-10H3 |
| InChIKey | GAFQCQFVIRUOEG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|