C21H36O3 — CID 6574189
(1R,2R,4R,6S)-5,5,6-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]bicyclo[2.2.1]heptan-2-ol (PubChem CID 6574189) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1R,2R,4R,6S)-5,5,6-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4R,6S)-5,5,6-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 6574189 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1R,2R,4R,6S)-5,5,6-trimethyl-2-[3-methyl-3-(2-methylpentan-2-ylperoxy)but-1-ynyl]bicyclo[2.2.1]heptan-2-ol |
| SMILES | CCCC(C)(C)OOC(C)(C)C#C[C@@]1(O)C[C@H]2C[C@@H]1[C@H](C)C2(C)C |
| InChI | InChI=1S/C21H36O3/c1-9-10-18(3,4)23-24-19(5,6)11-12-21(22)14-16-13-17(21)15(2)20(16,7)8/h15-17,22H,9-10,13-14H2,1-8H3/t15-,16+,17+,21+/m0/s1 |
| InChIKey | YTVVIHAUIVTBQY-BIZBXSGISA-N |
| XLogP | 4.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|