C12H18O — CID 50937774
(1S,2R,4S,6R)-2-ethynyl-5,5,6-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 50937774) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (1S,2R,4S,6R)-2-ethynyl-5,5,6-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2R,4S,6R)-2-ethynyl-5,5,6-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 50937774 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S,2R,4S,6R)-2-ethynyl-5,5,6-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C#C[C@@]1(O)C[C@@H]2C[C@H]1[C@@H](C)C2(C)C |
| InChI | InChI=1S/C12H18O/c1-5-12(13)7-9-6-10(12)8(2)11(9,3)4/h1,8-10,13H,6-7H2,2-4H3/t8-,9+,10+,12-/m1/s1 |
| InChIKey | PUNBHLKNELRXNV-FYLLDIAZSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|