C11H20INO — CID 21233726
4-ethynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol iodide (PubChem CID 21233726) has the molecular formula C11H20INO and a molecular weight of 309.19 g/mol. Its IUPAC name is 4-ethynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol iodide.
| Compound Name | 4-ethynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol iodide |
|---|---|
| PubChem CID | 21233726 |
| Molecular Formula | C11H20INO |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-ethynyl-1,1,2,5-tetramethylpiperidin-1-ium-4-ol iodide |
| SMILES | C#CC1(O)CC(C)[N+](C)(C)CC1C.[I-] |
| InChI | InChI=1S/C11H20NO.HI/c1-6-11(13)7-10(3)12(4,5)8-9(11)2;/h1,9-10,13H,7-8H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | JDFQXJZHGNXPTG-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|