C15H19OPS — CID 12602535
(1R,2R,4R,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-ol (PubChem CID 12602535) has the molecular formula C15H19OPS and a molecular weight of 278.36 g/mol. Its IUPAC name is (1R,2R,4R,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-ol.
| Compound Name | (1R,2R,4R,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-ol |
|---|---|
| PubChem CID | 12602535 |
| Molecular Formula | C15H19OPS |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (1R,2R,4R,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-ol |
| SMILES | C#C[C@@]1(O)C[C@@H](C)[P@@](=S)(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C15H19OPS/c1-4-15(16)10-13(3)17(18,11-12(15)2)14-8-6-5-7-9-14/h1,5-9,12-13,16H,10-11H2,2-3H3/t12-,13+,15+,17+/m0/s1 |
| InChIKey | FSSILIJHVYHJBV-TZDHZFECSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|