C20H26P2S2 — CID 132569703
3,3,6,6-tetramethyl-1,2-diphenyl-1,2-bis(sulfanylidene)-1λ5,2λ5-diphosphinane (PubChem CID 132569703) has the molecular formula C20H26P2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1,2-diphenyl-1,2-bis(sulfanylidene)-1λ5,2λ5-diphosphinane.
| Compound Name | 3,3,6,6-tetramethyl-1,2-diphenyl-1,2-bis(sulfanylidene)-1λ5,2λ5-diphosphinane |
|---|---|
| PubChem CID | 132569703 |
| Molecular Formula | C20H26P2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3,3,6,6-tetramethyl-1,2-diphenyl-1,2-bis(sulfanylidene)-1λ5,2λ5-diphosphinane |
| SMILES | CC1(C)CCC(C)(C)P(=S)(c2ccccc2)P1(=S)c1ccccc1 |
| InChI | InChI=1S/C20H26P2S2/c1-19(2)15-16-20(3,4)22(24,18-13-9-6-10-14-18)21(19,23)17-11-7-5-8-12-17/h5-14H,15-16H2,1-4H3 |
| InChIKey | FONZKZLYUSARFY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|