C11H13OPS — CID 134996545
5,5-dimethyl-2-phenyl-2-sulfanylidene-1,2λ5-oxaphosphole (PubChem CID 134996545) has the molecular formula C11H13OPS and a molecular weight of 224.26 g/mol. Its IUPAC name is 5,5-dimethyl-2-phenyl-2-sulfanylidene-1,2λ5-oxaphosphole.
| Compound Name | 5,5-dimethyl-2-phenyl-2-sulfanylidene-1,2λ5-oxaphosphole |
|---|---|
| PubChem CID | 134996545 |
| Molecular Formula | C11H13OPS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5,5-dimethyl-2-phenyl-2-sulfanylidene-1,2λ5-oxaphosphole |
| SMILES | CC1(C)C=CP(=S)(c2ccccc2)O1 |
| InChI | InChI=1S/C11H13OPS/c1-11(2)8-9-13(14,12-11)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | UTJXLAFDHUQLCO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|