C15H21OPS — CID 4657476
2,2,6,6-tetramethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-one (PubChem CID 4657476) has the molecular formula C15H21OPS and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-one.
| Compound Name | 2,2,6,6-tetramethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-one |
|---|---|
| PubChem CID | 4657476 |
| Molecular Formula | C15H21OPS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)P1(=S)c1ccccc1 |
| InChI | InChI=1S/C15H21OPS/c1-14(2)10-12(16)11-15(3,4)17(14,18)13-8-6-5-7-9-13/h5-9H,10-11H2,1-4H3 |
| InChIKey | OUYIKBVKMVVAHA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|