C19H23OP — CID 71385233
2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide (PubChem CID 71385233) has the molecular formula C19H23OP and a molecular weight of 298.37 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide.
| Compound Name | 2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide |
|---|---|
| PubChem CID | 71385233 |
| Molecular Formula | C19H23OP |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,2,4,4-tetramethyl-1-phenyl-3H-phosphinoline 1-oxide |
| SMILES | CC1(C)CC(C)(C)P(=O)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H23OP/c1-18(2)14-19(3,4)21(20,15-10-6-5-7-11-15)17-13-9-8-12-16(17)18/h5-13H,14H2,1-4H3 |
| InChIKey | XAYMJUHOSXENTI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|