C19H20BrOP — CID 132604573
2-bromo-4,4-diethyl-1-phenylphosphinoline 1-oxide (PubChem CID 132604573) has the molecular formula C19H20BrOP and a molecular weight of 375.25 g/mol. Its IUPAC name is 2-bromo-4,4-diethyl-1-phenylphosphinoline 1-oxide.
| Compound Name | 2-bromo-4,4-diethyl-1-phenylphosphinoline 1-oxide |
|---|---|
| PubChem CID | 132604573 |
| Molecular Formula | C19H20BrOP |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-bromo-4,4-diethyl-1-phenylphosphinoline 1-oxide |
| SMILES | CCC1(CC)C=C(Br)P(=O)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H20BrOP/c1-3-19(4-2)14-18(20)22(21,15-10-6-5-7-11-15)17-13-9-8-12-16(17)19/h5-14H,3-4H2,1-2H3 |
| InChIKey | BPIHXSCXLLJOSI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|