C11H13OPS — CID 11436036
(1S,2R,5R)-5-methyl-2-phenyl-2-sulfanylidene-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane (PubChem CID 11436036) has the molecular formula C11H13OPS and a molecular weight of 224.26 g/mol. Its IUPAC name is (1S,2R,5R)-5-methyl-2-phenyl-2-sulfanylidene-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane.
| Compound Name | (1S,2R,5R)-5-methyl-2-phenyl-2-sulfanylidene-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 11436036 |
| Molecular Formula | C11H13OPS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (1S,2R,5R)-5-methyl-2-phenyl-2-sulfanylidene-6-oxa-2λ5-phosphabicyclo[3.1.0]hexane |
| SMILES | C[C@@]12CC[P@@](=S)(c3ccccc3)[C@@H]1O2 |
| InChI | InChI=1S/C11H13OPS/c1-11-7-8-13(14,10(11)12-11)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,11+,13+/m0/s1 |
| InChIKey | VFKRWHBDVPFTIP-DMDPSCGWSA-N |
| XLogP | 2.31 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|