C18H22O2PS2Sb- — CID 10896224
CID 10896224 (PubChem CID 10896224) has the molecular formula C18H22O2PS2Sb- and a molecular weight of 487.24 g/mol.
| Compound Name | CID 10896224 |
|---|---|
| PubChem CID | 10896224 |
| Molecular Formula | C18H22O2PS2Sb- |
| Molecular Weight | 487.24 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | — |
| SMILES | CC1(C)OP(=S)([S-])OC1(C)C.c1ccc([Sb]c2ccccc2)cc1 |
| InChI | InChI=1S/C6H13O2PS2.2C6H5.Sb/c1-5(2)6(3,4)8-9(10,11)7-5;2*1-2-4-6-5-3-1;/h1-4H3,(H,10,11);2*1-5H;/p-1 |
| InChIKey | QPDFESPPMLMQSQ-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|