C18H29O3P — CID 102511213
2-[1-(4-tert-butylphenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 102511213) has the molecular formula C18H29O3P and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-[1-(4-tert-butylphenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 102511213 |
| Molecular Formula | C18H29O3P |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-[1-(4-tert-butylphenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CC(c1ccc(C(C)(C)C)cc1)P1(=O)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H29O3P/c1-13(14-9-11-15(12-10-14)16(2,3)4)22(19)20-17(5,6)18(7,8)21-22/h9-13H,1-8H3 |
| InChIKey | JQKIBMSZDFUVIQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|