C26H34O2 — CID 11838820
3-[bis(4-tert-butylphenyl)methyl]pentane-2,4-dione (PubChem CID 11838820) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-[bis(4-tert-butylphenyl)methyl]pentane-2,4-dione.
| Compound Name | 3-[bis(4-tert-butylphenyl)methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 11838820 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 3-[bis(4-tert-butylphenyl)methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H34O2/c1-17(27)23(18(2)28)24(19-9-13-21(14-10-19)25(3,4)5)20-11-15-22(16-12-20)26(6,7)8/h9-16,23-24H,1-8H3 |
| InChIKey | LCAUALMMUGNTGM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|