C13H18O3 — CID 129412348
(2R)-2-(4-tert-butylphenyl)-3-hydroxypropanoic acid (PubChem CID 129412348) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylphenyl)-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-(4-tert-butylphenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 129412348 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2R)-2-(4-tert-butylphenyl)-3-hydroxypropanoic acid |
| SMILES | CC(C)(C)c1ccc([C@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C13H18O3/c1-13(2,3)10-6-4-9(5-7-10)11(8-14)12(15)16/h4-7,11,14H,8H2,1-3H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | DLIZJBHHDJRLIM-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |