C13H22N2 — CID 20546388
1-(4-tert-butylphenyl)propane-1,2-diamine (PubChem CID 20546388) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)propane-1,2-diamine.
| Compound Name | 1-(4-tert-butylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 20546388 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)propane-1,2-diamine |
| SMILES | CC(N)C(N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H22N2/c1-9(14)12(15)10-5-7-11(8-6-10)13(2,3)4/h5-9,12H,14-15H2,1-4H3 |
| InChIKey | WSZLMXYRVBQVGS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |