C14H24N2 — CID 116948029
1-(4-tert-butylphenyl)-1-N-methylpropane-1,2-diamine (PubChem CID 116948029) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-(4-tert-butylphenyl)-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 116948029 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-1-N-methylpropane-1,2-diamine |
| SMILES | CNC(c1ccc(C(C)(C)C)cc1)C(C)N |
| InChI | InChI=1S/C14H24N2/c1-10(15)13(16-5)11-6-8-12(9-7-11)14(2,3)4/h6-10,13,16H,15H2,1-5H3 |
| InChIKey | BERWAAHECQUVOX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |