C9H14N2O — CID 24841393
4-(1,2-diaminopropyl)phenol (PubChem CID 24841393) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-(1,2-diaminopropyl)phenol.
| Compound Name | 4-(1,2-diaminopropyl)phenol |
|---|---|
| PubChem CID | 24841393 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4-(1,2-diaminopropyl)phenol |
| SMILES | CC(N)C(N)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H14N2O/c1-6(10)9(11)7-2-4-8(12)5-3-7/h2-6,9,12H,10-11H2,1H3 |
| InChIKey | SCCYMEASWPLBOQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |