C8H9F2NO — CID 130707257
4-[(1R)-1-amino-2,2-difluoroethyl]phenol (PubChem CID 130707257) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2,2-difluoroethyl]phenol.
| Compound Name | 4-[(1R)-1-amino-2,2-difluoroethyl]phenol |
|---|---|
| PubChem CID | 130707257 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 4-[(1R)-1-amino-2,2-difluoroethyl]phenol |
| SMILES | N[C@H](c1ccc(O)cc1)C(F)F |
| InChI | InChI=1S/C8H9F2NO/c9-8(10)7(11)5-1-3-6(12)4-2-5/h1-4,7-8,12H,11H2/t7-/m1/s1 |
| InChIKey | IYOYFGLFLKRBRA-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |