C8H9F2NO2 — CID 130642566
5-[(1R)-1-amino-2,2-difluoroethyl]benzene-1,3-diol (PubChem CID 130642566) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 5-[(1R)-1-amino-2,2-difluoroethyl]benzene-1,3-diol.
| Compound Name | 5-[(1R)-1-amino-2,2-difluoroethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 130642566 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 5-[(1R)-1-amino-2,2-difluoroethyl]benzene-1,3-diol |
| SMILES | N[C@H](c1cc(O)cc(O)c1)C(F)F |
| InChI | InChI=1S/C8H9F2NO2/c9-8(10)7(11)4-1-5(12)3-6(13)2-4/h1-3,7-8,12-13H,11H2/t7-/m1/s1 |
| InChIKey | UXOFXGQIJMEUBK-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |