C18H29O4PSe — CID 12901866
2,2,3,3,7,7,8,8-octamethyl-5-phenylselanyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane (PubChem CID 12901866) has the molecular formula C18H29O4PSe and a molecular weight of 419.36 g/mol. Its IUPAC name is 2,2,3,3,7,7,8,8-octamethyl-5-phenylselanyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane.
| Compound Name | 2,2,3,3,7,7,8,8-octamethyl-5-phenylselanyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane |
|---|---|
| PubChem CID | 12901866 |
| Molecular Formula | C18H29O4PSe |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2,2,3,3,7,7,8,8-octamethyl-5-phenylselanyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane |
| SMILES | CC1(C)OP2([Se]c3ccccc3)(OC1(C)C)OC(C)(C)C(C)(C)O2 |
| InChI | InChI=1S/C18H29O4PSe/c1-15(2)16(3,4)20-23(19-15,24-14-12-10-9-11-13-14)21-17(5,6)18(7,8)22-23/h9-13H,1-8H3 |
| InChIKey | BODZCCHTHULGKM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|