C19H16P2S2 — CID 102113163
1,3-diphenyl-1,3-bis(sulfanylidene)-2H-1λ5,3λ5-benzodiphosphole (PubChem CID 102113163) has the molecular formula C19H16P2S2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1,3-diphenyl-1,3-bis(sulfanylidene)-2H-1λ5,3λ5-benzodiphosphole.
| Compound Name | 1,3-diphenyl-1,3-bis(sulfanylidene)-2H-1λ5,3λ5-benzodiphosphole |
|---|---|
| PubChem CID | 102113163 |
| Molecular Formula | C19H16P2S2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1,3-diphenyl-1,3-bis(sulfanylidene)-2H-1λ5,3λ5-benzodiphosphole |
| SMILES | S=P1(c2ccccc2)CP(=S)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H16P2S2/c22-20(16-9-3-1-4-10-16)15-21(23,17-11-5-2-6-12-17)19-14-8-7-13-18(19)20/h1-14H,15H2 |
| InChIKey | ZXLIIQFITYPIHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|