C17H32NO2+ — CID 7320316
(2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,1,2,5-tetramethylpiperidin-1-ium-4-ol (PubChem CID 7320316) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,1,2,5-tetramethylpiperidin-1-ium-4-ol.
| Compound Name | (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,1,2,5-tetramethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7320316 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (2S,4S,5R)-4-[(E)-2-(1-hydroxycyclohexyl)ethenyl]-1,1,2,5-tetramethylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1C[N+](C)(C)[C@@H](C)C[C@]1(O)/C=C/C1(O)CCCCC1 |
| InChI | InChI=1S/C17H32NO2/c1-14-13-18(3,4)15(2)12-17(14,20)11-10-16(19)8-6-5-7-9-16/h10-11,14-15,19-20H,5-9,12-13H2,1-4H3/q+1/b11-10+/t14-,15+,17-/m1/s1 |
| InChIKey | SEWNTSZJYCRBLN-XQNFUTKTSA-N |
| XLogP | 2.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|