C13H21NO — CID 591750
4-ethynyl-2,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol (PubChem CID 591750) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-ethynyl-2,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol.
| Compound Name | 4-ethynyl-2,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol |
|---|---|
| PubChem CID | 591750 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-ethynyl-2,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol |
| SMILES | C#CC1(O)CC(C)NC2CC(C)CCC21 |
| InChI | InChI=1S/C13H21NO/c1-4-13(15)8-10(3)14-12-7-9(2)5-6-11(12)13/h1,9-12,14-15H,5-8H2,2-3H3 |
| InChIKey | UXHWOWQNSYDIAK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|