C11H21NO — CID 130762249
(2R,4R,4aS,7S,8aS)-2,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-ol (PubChem CID 130762249) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2R,4R,4aS,7S,8aS)-2,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-ol.
| Compound Name | (2R,4R,4aS,7S,8aS)-2,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-ol |
|---|---|
| PubChem CID | 130762249 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2R,4R,4aS,7S,8aS)-2,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-ol |
| SMILES | C[C@H]1CC[C@@H]2[C@H](O)C[C@@H](C)N[C@H]2C1 |
| InChI | InChI=1S/C11H21NO/c1-7-3-4-9-10(5-7)12-8(2)6-11(9)13/h7-13H,3-6H2,1-2H3/t7-,8+,9-,10-,11+/m0/s1 |
| InChIKey | WDDMLCBUOYCHSI-HPENLJRUSA-N |
| XLogP | 1.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |